Albothricin | CAS No. | 103867-06-7 |
| Molecular Weight | 500.55 |
| Formula | C20H36N8O7 |
| SMILES | O=C1[C@](N=C(N[C@H]2[C@H](NC(C[C@@H](N)CCCN)=O)[C@@H]([C@H]([C@@H](CO)O2)OC(N)=O)O)N3)([H])[C@@]3([H])CCN1C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23804 | Cytochalasin G | Inquiry |
|
| MDP-22169 | Formamide (Standard) | Inquiry |
|
| MDP-24305 | Galactostatin | Inquiry |
|
| MDP-23653 | 10-Decarbomethoxyaclacinomycin A | Inquiry |
|
| MDP-22977 | Leustroducsin B | Inquiry |
|
| MDP-11560 | 7-Methylxanthine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
