Cytochalasin G | CAS No. | 54874-57-6 |
| Molecular Weight | 474.59 |
| Formula | C29H34N2O4 |
| SMILES | O=C(CCC1=O)C[C@@H](C)C/C=C/[C@]2([H])[C@]31C(N[C@@H](CC4=CNC5=C4C=CC=C5)[C@]3([H])[C@H](C)[C@]6(C)[C@@]2([H])O6)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23625 | Dunaimycin A1 | Inquiry |
|
| MDP-12638 | Mycestericin C | Inquiry |
|
| MDP-11049 | Acarbose | Inquiry |
|
| MDP-23004 | Sarubicin B | Inquiry |
|
| MDP-22878 | Fiscalin C | Inquiry |
|
| MDP-24217 | Chivosazol A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
