Amphotericin B | CAS No. | 1397-89-3 |
| Purity | ≥98.0% |
| Molecular Weight | 924.08 |
| Formula | C47H73NO17 |
| Appearance | Solid |
| Color | Light yellow to yellow |
| SMILES | C[C@H]([C@@H](O)[C@@H](C)[C@H](C)OC1=O)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](O[C@]2([H])O[C@H](C)[C@@H](O)[C@H](N)[C@@H]2O)C[C@@]3([H])[C@H](C(O)=O)[C@@H](O)C[C@](C[C@@H](O)C[C@@H](O)[C@H](O)CC[C@@H](O)C[C@@H](O)C1)(O)O3 |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11321 | Tryptophol | Inquiry |
|
| MDP-11767 | 2-Acetylfuran | Inquiry |
|
| MDP-23682 | 2-Hydroxymethylclavam | Inquiry |
|
| MDP-12495 | Reticulol | Inquiry |
|
| MDP-22533 | Argyrin B | Inquiry |
|
| MDP-23689 | Fostriecin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
