Fostriecin | CAS No. | 87810-56-8 |
| Synonyms | PD 110161; CL 1565A; CI-920 |
| Molecular Weight | 430.39 |
| Formula | C19H27O9P |
| SMILES | O=C(C=CC1)O[C@H]1/C=C/[C@@](C)(O)[C@H](OP(O)(O)=O)C[C@@H](O)/C=C\C=C/C=C/CO |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23458 | Arylomycin A3 | Inquiry |
|
| MDP-23799 | Halymecin B | Inquiry |
|
| MDP-24333 | Polyozellin | Inquiry |
|
| MDP-22858 | Pyrenocine A | Inquiry |
|
| MDP-12549 | Aspergillin PZ | Inquiry |
|
| MDP-22968 | Racemomycin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
