Amythiamicin A | CAS No. | 152741-89-4 |
| Molecular Weight | 1182.43 |
| Formula | C50H51N15O8S6 |
| SMILES | O=C1NCC(NC(C(C)C)C2=NC(C3=NC(C4=C(C5=NC(C(NC(CC(NC)=O)C6=NC(C(NC(C(C)C)C7=NC1=CS7)=O)=C(C)S6)=O)=CS5)C=CC(C8=NC(C9=NC(CO9)C(N%10CCCC%10C(N)=O)=O)=CS8)=N4)=CS3)=CS2)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12375 | 1-Phenylethane-1,2-diol | Inquiry |
|
| MDP-22358 | Tobramycin (Standard) | Inquiry |
|
| MDP-12139 | Daunorubicin | Inquiry |
|
| MDP-23396 | Arborcandin B | Inquiry |
|
| MDP-23871 | Elsamicin B | Inquiry |
|
| MDP-12198 | Orellanine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.