Anguibactin | CAS No. | 104245-09-2 |
| Molecular Weight | 348.38 |
| Formula | C15H16N4O4S |
| SMILES | OC1=C(C=CC=C1O)C2=N[C@@H](CS2)C(N(O)CCC3=CN=CN3)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11998 | (2R,3R)-Butane-2,3-diol | Inquiry |
|
| MDP-22280 | Chenodeoxycholic Acid (Standard) | Inquiry |
|
| MDP-23433 | Aranorosinol A | Inquiry |
|
| MDP-12501 | Rimocidin | Inquiry |
|
| MDP-24188 | 1-Hydroxyauramycin B | Inquiry |
|
| MDP-23870 | Louisianin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
