Anhuienside F | CAS | 349655-29-4 |
| Molecular Weight | 1367.52 |
| Formula | C65H106O30 |
| SMILES | O[C@@H]1[C@@H]([C@H]([C@@H](O[C@H]1O[C@H]2[C@@H]([C@H]([C@H](OC[C@H]3O[C@H]([C@@H]([C@H]([C@@H]3O)O)O)OC([C@]45CCC(C)(C[C@H]4C6=CC[C@H]7[C@@](CC[C@H]8C(C)([C@H](CC[C@]78C)O[C@@H]9OC[C@H]([C@@H]([C@H]9O[C@@H]%10O[C@H]([C@@H]([C@H]([C@H]%10O)O[C@@H]%11O[C@@H]([C@H]([C@@H]([C@H]%11O)O)O)CO)O)C)O)O)C)([C@@]6(CC5)C)C)C)=O)O[C@@H]2CO)O)O)C)O)O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19836 | Corydaline (Standard) | Inquiry |
|
| PDP-17837 | Ginsenoside Rs1 | Inquiry |
|
| PDP-18242 | Dugesin B | Inquiry |
|
| PDP-18659 | Rabdosin C | Inquiry |
|
| PDP-16944 | Isomahanimbine | Inquiry |
|
| PDP-18522 | Rhodiocyanoside A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
