Corydaline (Standard) | CAS | 518-69-4 |
| Molecular Weight | 369.45 |
| Formula | C22H27NO4 |
| SMILES | C[C@@H](C1=CC=C2OC)[C@]3([H])C4=CC(OC)=C(OC)C=C4CCN3CC1=C2OC |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19936 | Camelliaside B (Standard) | Inquiry |
|
| PDP-16804 | Arecoline Hydrochloride | Inquiry |
|
| PDP-15386 | Isoforskolin | Inquiry |
|
| PDP-17666 | Forrestiacids K | Inquiry |
|
| PDP-16202 | (+)-Epipinoresinol | Inquiry |
|
| PDP-17887 | Hyperelamine A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
