β-Anhydroicaritin | Synonyms | Cycloicaritin |
| Appearance | Solid |
| CAS | 38226-86-7 |
| Purity | 99.69% |
| Molecular Weight | 368.38 |
| Formula | C21H20O6 |
| Color | Light yellow to yellow |
| SMILES | O=C1C2=C(O)C=C3C(CCC(C)(C)O3)=C2OC(C4=CC=C(OC)C=C4)=C1O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13059 | Puerarin | Inquiry |
|
| PDP-14954 | Onjisaponin B | Inquiry |
|
| PDP-16242 | Ardisicrenoside A | Inquiry |
|
| PDP-20243 | Aloinoside A | Inquiry |
|
| PDP-19555 | Isoscoparin-7-O-glucoside | Inquiry |
|
| PDP-14195 | Estragole | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
