(-)-Anomalin | Synonyms | (-)-Praeruptorin B |
| Appearance | Solid |
| CAS | 4970-26-7 |
| Purity | 99.81% |
| Molecular Weight | 426.46 |
| Formula | C24H26O7 |
| Color | White to yellow |
| SMILES | O=C(C=C1)OC2=C1C=CC3=C2[C@@H](OC(/C(C)=C\C)=O)[C@@H](OC(/C(C)=C\C)=O)C(C)(C)O3 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15904 | DL-Xylose | Inquiry |
|
| PDP-17235 | Xanthine Oxidase-IN-9 | Inquiry |
|
| PDP-20475 | Diacerein (Standard) | Inquiry |
|
| PDP-19573 | (-)-Hinesol | Inquiry |
|
| PDP-19838 | Hinokinin (Standard) | Inquiry |
|
| PDP-18137 | Neostenine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
