Antioxidant Agent-18 | CAS | 143016-73-3 |
| Molecular Weight | 918.80 |
| Formula | C42H46O23 |
| SMILES | O=C(C(O[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)O)O)O[C@@H]2O[C@@H]([C@H]([C@@H]([C@H]2O)O)O)COC(/C=C/C3=CC=C(C=C3)O)=O)=C(C4=CC(O)=C(C=C4)O)OC5=CC(O[C@@H]6O[C@@H]([C@H]([C@@H]([C@H]6O)O)O)CO)=C7)C5=C7O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19155 | (S)-4-Methoxydalbergione | Inquiry |
|
| PDP-19658 | Schisandrin C (Standard) | Inquiry |
|
| PDP-15294 | 3-Isomangostin | Inquiry |
|
| PDP-14007 | Triacetylresveratrol | Inquiry |
|
| PDP-18481 | Perisesaccharide B | Inquiry |
|
| PDP-19719 | Forsythiaside A (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
