Forsythiaside A (Standard) | CAS | 79916-77-1 |
| Molecular Weight | 624.59 |
| Formula | C29H36O15 |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](O)[C@H](OC[C@@H]2[C@@H](OC(/C=C/C3=CC=C(O)C(O)=C3)=O)[C@H](O)[C@@H](O)[C@H](OCCC4=CC(O)=C(O)C=C4)O2)O[C@H]1C |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18158 | Momordicoside G | Inquiry |
|
| PDP-17262 | Bruceantarin | Inquiry |
|
| PDP-13662 | Deoxyshikonin | Inquiry |
|
| PDP-19941 | Grosvenorine (Standard) | Inquiry |
|
| PDP-18642 | 3-O-(2'E,4'Z-Decadienoyl)ingenol | Inquiry |
|
| PDP-17487 | Epimedonin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
