Apigeninidin Chloride | Synonyms | Gesneridin Chloride; Apigenidin Chloride |
| CAS | 1151-98-0 |
| Molecular Weight | 290.70 |
| Formula | C15H11ClO4 |
| SMILES | OC1=CC(O)=C2C=CC(C3=CC=C(C=C3)O)=[O+]C2=C1.[Cl-] |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15546 | Helveticoside | Inquiry |
|
| PDP-13375 | Garcinol | Inquiry |
|
| PDP-19759 | Harpagide (Standard) | Inquiry |
|
| PDP-14984 | Sanggenon G | Inquiry |
|
| PDP-15687 | Licoflavone B | Inquiry |
|
| PDP-18569 | Daphylloside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
