Aposcopolamine (Standard) | CAS | 535-26-2 |
| Molecular Weight | 285.34 |
| Formula | C₁₇H₁₉NO₃ |
| SMILES | CN1[C@@](C2)([H])[C@]3([H])[C@@]([C@]1([H])C[C@@H]2OC(C(C4=CC=CC=C4)=C)=O)([H])O3 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17496 | Rebaudioside S | Inquiry |
|
| PDP-13961 | Hydroquinidine | Inquiry |
|
| PDP-13551 | Crocetin | Inquiry |
|
| PDP-18328 | Dihydromicromelin B | Inquiry |
|
| PDP-18552 | 7-O-Methyl Morroniside | Inquiry |
|
| PDP-14655 | 1-Pentadecanol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
