Arisugacin F | CAS No. | 261951-44-4 |
| Molecular Weight | 438.56 |
| Formula | C27H34O5 |
| SMILES | C[C@@]12[C@]3([H])[C@](OC4=C(C(OC(C5=CC=C(C=C5)OC)=C4)=O)C3)(CC[C@@]1([H])C(C)([C@H](CC2)O)C)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11956 | Undecane | Inquiry |
|
| MDP-23233 | Decyl Aldehyde (Standard) | Inquiry |
|
| MDP-23187 | Decatromicin B | Inquiry |
|
| MDP-21901 | Berkeleylactone F | Inquiry |
|
| MDP-12271 | Terpinen-4-ol (Standard) | Inquiry |
|
| MDP-12577 | Beauverolide Ka | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
