Arteminin | CAS | 466639-11-2 |
| Molecular Weight | 222.19 |
| Formula | C11H10O5 |
| SMILES | OC1=C(OC)C=C(C(O2)=C1C=CC2=O)OC |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15096 | Cinnamtannin B-1 | Inquiry |
|
| PDP-16153 | Notoginsenoside T5 | Inquiry |
|
| PDP-14777 | Magnesium Lithospermate B | Inquiry |
|
| PDP-17902 | Scutebarbatine A | Inquiry |
|
| PDP-19529 | Methylzedoarondiol | Inquiry |
|
| PDP-18896 | Carpinontriol B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
