Astin B | CAS | 151201-76-2 |
| Molecular Weight | 586.46 |
| Formula | C25H33Cl2N5O7 |
| SMILES | Cl[C@H](C1)[C@@H](Cl)[C@@](N1C([C@H](CC)NC(C[C@H](C2=CC=CC=C2)N3)=O)=O)([H])C(N[C@H]([C@H](C)O)C(N[C@@H](CO)C3=O)=O)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16948 | Lobetyol | Inquiry |
|
| PDP-17042 | Methylenedihydrotanshinquinone | Inquiry |
|
| PDP-19259 | Tiliroside (Standard) | Inquiry |
|
| PDP-17562 | Complanatin I | Inquiry |
|
| PDP-16228 | Sterebin E | Inquiry |
|
| PDP-17286 | 10α-Hydroxyepigambogic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
