Atanine | CAS | 7282-19-1 |
| Molecular Weight | 243.30 |
| Formula | C15H17NO2 |
| SMILES | O=C1NC2=C(C(OC)=C1C/C=C(C)\C)C=CC=C2 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14853 | Physcion 8-O-β-D-glucopyranoside | Inquiry |
|
| PDP-16177 | L-Stepholidine | Inquiry |
|
| PDP-16470 | Cucurbitacin B (Standard) | Inquiry |
|
| PDP-18909 | Retronecine | Inquiry |
|
| PDP-17927 | Rengyol | Inquiry |
|
| PDP-20257 | (Rac)-Ganoderic Acid C2 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
