L-Stepholidine | Synonyms | Stepholidine; (-)-Stepholidine; L-SPD |
| Appearance | Solid |
| CAS | 16562-13-3 |
| Purity | 99.79% |
| Molecular Weight | 327.37 |
| Formula | C19H21NO4 |
| Color | White to off-white |
| SMILES | OC1=C(OC)C=C(CCN2CC3=C(OC)C(O)=CC=C3C[C@]24[H])C4=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13023 | Cnidium Monnieri Extract | Inquiry |
|
| PDP-18465 | Isocucurbitacin B | Inquiry |
|
| PDP-19402 | 2-Acetoxy-3-deacetoxycaesaldekarin E | Inquiry |
|
| PDP-15148 | Mudanpioside C | Inquiry |
|
| PDP-13885 | Oleandrin | Inquiry |
|
| PDP-18845 | Arundinin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
