Atractyloside A | Appearance | Solid |
| CAS | 126054-77-1 |
| Purity | ≥98.0% |
| Molecular Weight | 448.50 |
| Formula | C21H36O10 |
| Color | White to light yellow |
| SMILES | O=C1[C@@](C)(O)[C@]2([H])C[C@H](C(C)(O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)C)CC[C@@](CO)(O)[C@@]2([H])C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17981 | Ligupurpuroside B | Inquiry |
|
| PDP-19008 | Coulteropine | Inquiry |
|
| PDP-13959 | Cyclovirobuxine D | Inquiry |
|
| PDP-16444 | (E)-Cinnamamide | Inquiry |
|
| PDP-16628 | Glucoerucin Potassium | Inquiry |
|
| PDP-15158 | Nordihydrocapsaicin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
