Atrovenetin | CAS No. | 2582-86-7 |
| Molecular Weight | 342.34 |
| Formula | C19H18O6 |
| SMILES | CC(C(C1=C2C(O)=C3O)=C(O[C@@H](C4(C)C)C)C4=C(O)C1=C3O)=CC2=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12156 | Conglobatin | Inquiry |
|
| MDP-11591 | D-Allose | Inquiry |
|
| MDP-24355 | Hypelcin A-II | Inquiry |
|
| MDP-11615 | Ikarugamycin | Inquiry |
|
| MDP-22418 | Lachnone A | Inquiry |
|
| MDP-24362 | Phenylacetylglutamine (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
