Aurachin B | CAS No. | 108354-12-7 |
| Molecular Weight | 379.54 |
| Formula | C25H33NO2 |
| SMILES | OC1=C([N+]([O-])=C2C=CC=CC2=C1C/C=C(CC/C=C(CC/C=C(C)\C)\C)\C)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24338 | Homoalanosine | Inquiry |
|
| MDP-22558 | Ganodermanontriol (Standard) | Inquiry |
|
| MDP-12480 | Fumitremorgin B | Inquiry |
|
| MDP-23328 | Kibdelone B | Inquiry |
|
| MDP-11382 | O-Phospho-L-serine | Inquiry |
|
| MDP-12026 | 3-Methyl-2-oxovaleric Acid (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
