Kibdelone B | CAS No. | 934464-78-5 |
| Molecular Weight | 583.97 |
| Formula | C29H26ClNO10 |
| SMILES | OC1=C2C3=C(CCC2=C(C4=C1C(C5=C([C@H](C[C@@H]([C@@H]5O)O)O)O4)=O)OC)C(C6=C(C(N(C(CCC)=C6Cl)C)=O)C3=O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11633 | Adenosine-2'-monophosphate | Inquiry |
|
| MDP-22779 | Adenosine 5'-diphosphoribose (Standard) | Inquiry |
|
| MDP-23030 | 3,5-Diiodo-L-tyrosine (Standard) | Inquiry |
|
| MDP-12516 | Illudin M | Inquiry |
|
| MDP-11764 | 1-Methyluric Acid | Inquiry |
|
| MDP-12115 | Guanosine (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
