Avidinorubicin | CAS No. | 135447-13-1 |
| Molecular Weight | 1215.34 |
| Formula | C60H86N4O22 |
| SMILES | C[C@@H]1O[C@@H](O[C@@H]2[C@](N)(C[C@H](O[C@H]2C)O[C@@H]3[C@](N)(C[C@H](O[C@H]3C)O[C@@H]4[C@@]5(O[C@H]([C@H]([C@@H]4N(C)C)O)OC6=C7C(C(C(C(O)=C89)=C(C7=O)C(O)=C9C[C@@](O)(C[C@@H]8O[C@H]%10C[C@@H]([C@@H]([C@@H](O%10)C)O)N(C)C)C)=O)=CC=C56)C)C)C)C[C@@H]([C@@H]1OC(CCC(O)=O)=O)OC |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24244 | Pradimicin B | Inquiry |
|
| MDP-21950 | Dihydronovobiocin | Inquiry |
|
| MDP-23190 | Bisucaberin | Inquiry |
|
| MDP-22995 | Lachnumon | Inquiry |
|
| MDP-23706 | Mutalomycin | Inquiry |
|
| MDP-23960 | Mycoplanecin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
