Baimaside (Standard) | CAS | 18609-17-1 |
| Molecular Weight | 626.52 |
| Formula | C27H30O17 |
| SMILES | O=C1C(O[C@H](O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]2O[C@]([C@@H]([C@@H](O)[C@@H]3O)O)([H])O[C@@H]3CO)=C(C4=CC(O)=C(O)C=C4)OC5=CC(O)=CC(O)=C15 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17028 | Esculentoside C | Inquiry |
|
| PDP-18024 | Uvarigrin | Inquiry |
|
| PDP-19967 | D-(+)-Fucose (Standard) | Inquiry |
|
| PDP-15851 | Metacetamol | Inquiry |
|
| PDP-15906 | 5,6-Dihydropyridin-2(1H)-one | Inquiry |
|
| PDP-19045 | Sanggenofuran B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
