Sanggenofuran B | CAS | 1017277-40-5 |
| Molecular Weight | 324.37 |
| Formula | C20H20O4 |
| SMILES | OC1=CC(C2=CC3=CC=C(OC)C=C3O2)=CC(O)=C1C/C=C(C)\C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18368 | Eudesm-4(14)-ene-3α,11-diol | Inquiry |
|
| PDP-17336 | (2S)-4'-Hydroxy-7-methoxyflavan | Inquiry |
|
| PDP-16608 | Digoxigenin (Standard) | Inquiry |
|
| PDP-19523 | Noraucuparin | Inquiry |
|
| PDP-16644 | Scopoletin (Standard) | Inquiry |
|
| PDP-13299 | Xanthohumol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
