Bavachromene | CAS | 41743-38-8 |
| Molecular Weight | 322.35 |
| Formula | C20H18O4 |
| SMILES | O=C(C1=C(O)C=C2C(C=CC(C)(C)O2)=C1)/C=C/C3=CC=C(O)C=C3 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14692 | Mogroside IV-A | Inquiry |
|
| PDP-13846 | Umbellulone | Inquiry |
|
| PDP-15338 | 3-Deoxyaconitine | Inquiry |
|
| PDP-14429 | Flavokawain B | Inquiry |
|
| PDP-19264 | Kokusaginine | Inquiry |
|
| PDP-18292 | Ethoxycoronarin D | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
