Umbellulone | Appearance | Oil |
| CAS | 546-78-1 |
| Purity | 99.60% |
| Molecular Weight | 150.22 |
| Formula | C10H14O |
| Color | Colorless to light yellow |
| SMILES | O=C1[C@@]2(C(C)C)C[C@@]2([H])C(C)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Pure form -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16095 | Dihydromorin | Inquiry |
|
| PDP-13918 | D-Mannuronic Acid Sodium | Inquiry |
|
| PDP-13965 | DL-Mannitol | Inquiry |
|
| PDP-15771 | Macrozamin | Inquiry |
|
| PDP-13819 | Eupalinolide B | Inquiry |
|
| PDP-18334 | Drahebenine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
