Bikaverin | CAS No. | 33390-21-5 |
| Synonyms | Lycopersin |
| Molecular Weight | 382.32 |
| Formula | C20H14O8 |
| Appearance | Solid |
| Color | Brown to reddish brown |
| SMILES | O=C1C(OC)=CC(C2=C(O)C(C3=O)=C(OC4=C3C(C)=CC(OC)=C4)C(O)=C21)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22269 | Amicoumacin B | Inquiry |
|
| MDP-12397 | Phenyl Acetate (Standard) | Inquiry |
|
| MDP-22218 | Levinoid C | Inquiry |
|
| MDP-23977 | Gibbestatin B | Inquiry |
|
| MDP-22995 | Lachnumon | Inquiry |
|
| MDP-11069 | Riboflavin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
