Binankadsurin A | CAS | 77165-79-8 |
| Molecular Weight | 402.44 |
| Formula | C22H26O7 |
| SMILES | C[C@@H]1[C@@H](O)C2=C(C(OC)=C(OCO3)C3=C2)C4=C(C[C@H]1C)C=C(OC)C(OC)=C4O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16767 | 4-Ethylresorcinol | Inquiry |
|
| PDP-15172 | Rosamultin | Inquiry |
|
| PDP-13229 | Polyphyllin VI | Inquiry |
|
| PDP-13271 | Costunolide | Inquiry |
|
| PDP-15687 | Licoflavone B | Inquiry |
|
| PDP-17072 | Guajadial F | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
