Boeravinone A | CAS | 114567-33-8 |
| Molecular Weight | 326.30 |
| Formula | C18H14O6 |
| SMILES | O=C1C2=C(C(OC)OC3=CC=CC=C32)OC4=CC(O)=C(C)C(O)=C14 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18122 | Ohchinin Acetate | Inquiry |
|
| PDP-13832 | Octyl Gallate | Inquiry |
|
| PDP-14012 | 9-Aminocamptothecin | Inquiry |
|
| PDP-16450 | Myricetin (Standard) | Inquiry |
|
| PDP-17653 | Donasine | Inquiry |
|
| PDP-20490 | Licochalcone B (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
