Borapetoside F | CAS | 151200-50-9 |
| Molecular Weight | 534.55 |
| Formula | C27H34O11 |
| SMILES | O=C(C1=CCC[C@@]2([H])[C@]1(C)[C@H](O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)C=C([C@]2(C)C[C@H](C4=COC=C4)O5)C5=O)OC |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13099 | Etoposide | Inquiry |
|
| PDP-18402 | Glycosolone | Inquiry |
|
| PDP-20069 | Lactucin (Standard) | Inquiry |
|
| PDP-19126 | Wilforlide B | Inquiry |
|
| PDP-14888 | 3-O-Acetyl-α-boswellic Acid | Inquiry |
|
| PDP-19333 | Wulignan A1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
