Wulignan A1 | CAS | 117047-76-4 |
| Molecular Weight | 342.39 |
| Formula | C20H22O5 |
| SMILES | O=C1[C@@H](C)[C@@H](C)[C@H](C2=CC=C(O)C(OC)=C2)C3=C1C=C(O)C(OC)=C3 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15191 | Venuloside A | Inquiry |
|
| PDP-17253 | Cellooctaose | Inquiry |
|
| PDP-18718 | Demethylcarolignan E | Inquiry |
|
| PDP-19213 | trans-N-Methyl-4-methoxyproline | Inquiry |
|
| PDP-15762 | Picein | Inquiry |
|
| PDP-18475 | Clematomandshurica Saponin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
