Bruceine C | CAS | 25514-30-1 |
| Molecular Weight | 564.58 |
| Formula | C28H36O12 |
| SMILES | COC([C@]12[C@@]3([H])[C@@]4(CO2)[C@@]([C@H]([C@@H]1O)O)([H])[C@@]5([C@@](C(C)=C(C(C5)=O)O)([H])C[C@@]4([H])OC([C@@H]3OC(/C=C(C)/C(C)(O)C)=O)=O)C)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16294 | Ethyl 3,4,5-trimethoxybenzoate | Inquiry |
|
| PDP-15119 | Methyl Isoeugenol | Inquiry |
|
| PDP-18953 | Isodonal | Inquiry |
|
| PDP-16174 | Danshenxinkun B | Inquiry |
|
| PDP-14039 | Monotropein | Inquiry |
|
| PDP-20393 | Triptonide (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
