Methyl Isoeugenol | Appearance | Liquid (Density: 1.05 g/cm3) |
| CAS | 93-16-3 |
| Purity | 98.11% |
| Molecular Weight | 178.23 |
| Formula | C11H14O2 |
| Color | Colorless to light yellow |
| SMILES | C/C=C/C1=CC=C(OC)C(OC)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Pure form -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13026 | Elderberry Fruit Extract | Inquiry |
|
| PDP-15334 | Picfeltarraenin IB | Inquiry |
|
| PDP-15559 | Methylophiopogonone B | Inquiry |
|
| PDP-15132 | Ginkgo Biloba Extract | Inquiry |
|
| PDP-16951 | Apigeninidin Chloride | Inquiry |
|
| PDP-15865 | Condurango Glycoside A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
