Calycosin (Standard) | CAS | 20575-57-9 |
| Molecular Weight | 284.26 |
| Formula | C₁₆H₁₂O₅ |
| SMILES | O=C1C(C2=CC=C(OC)C(O)=C2)=COC3=CC(O)=CC=C13 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20286 | Akuammiline | Inquiry |
|
| PDP-19449 | Walsuronoid B | Inquiry |
|
| PDP-16061 | Lindleyin | Inquiry |
|
| PDP-19219 | 5-Hydroxyalizarin 1-methyl Ether | Inquiry |
|
| PDP-17098 | γ-L-Glutamyl-S-allyl-L-cysteine | Inquiry |
|
| PDP-15278 | Ganoderic Acid D2 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
