Cannabinodiol | Appearance | Liquid |
| CAS | 39624-81-2 |
| Molecular Weight | 310.43 |
| Formula | C21H26O2 |
| SMILES | OC1=C(C(O)=CC(CCCCC)=C1)C2=C(C=CC(C)=C2)C(C)=C |
| Intended Use | For research and further manufacturing use only. |
| Storage | Solution, -20°C, 2 years |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18934 | 3,4,5-Trimethoxyphenyl-(6'-O-galloyl)-O-β-D-glucopyranoside | Inquiry |
|
| PDP-14932 | Methyl Citrate | Inquiry |
|
| PDP-13676 | Nootkatone | Inquiry |
|
| PDP-17107 | Laxiflorin B | Inquiry |
|
| PDP-16724 | Nortrachelogenin | Inquiry |
|
| PDP-19387 | Dehydrodicentrine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
