β-Caryophyllene (Standard) | Synonyms | (-)-(E)-Caryophyllene(Standard); (−)-β-caryophyllene(Standard); (−)-trans-Caryophyllene (Standard) |
| Appearance | Liquid (Density: 0.9046 g/cm³) |
| CAS | 87-44-5 |
| Purity | 98.78% |
| Molecular Weight | 204.35 |
| Formula | C₁₅H₂₄ |
| Color | Colorless to light yellow |
| SMILES | C=C1CC/C=C(C)/CC[C@@]2([H])C(C)(C)C[C@]12[H] |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18802 | Dihydromollugin | Inquiry |
|
| PDP-15404 | Dicentrine | Inquiry |
|
| PDP-20497 | Artemether (Standard) | Inquiry |
|
| PDP-14613 | 5-Heptadecylresorcinol | Inquiry |
|
| PDP-14576 | Crebanine | Inquiry |
|
| PDP-17068 | Taxinine M | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
