Caulophine | CAS | 1159989-19-1 |
| Molecular Weight | 343.37 |
| Formula | C19H21NO5 |
| SMILES | CN(CCC(C=C(OC)C1=C2C3=C(C(OC)=CC=C3C1=O)O)=C2O)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19226 | Pipernonaline | Inquiry |
|
| PDP-13364 | Dibutyl Phthalate | Inquiry |
|
| PDP-19411 | Shyobunone | Inquiry |
|
| PDP-15093 | Syringaresinol Diglucoside | Inquiry |
|
| PDP-14954 | Onjisaponin B | Inquiry |
|
| PDP-20430 | Curcumol (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
