Celastrol | Synonyms | Tripterine; Tripterin |
| Appearance | Solid |
| CAS | 34157-83-0 |
| Purity | 99.90% |
| Molecular Weight | 450.61 |
| Formula | C29H38O4 |
| Color | Orange to red |
| SMILES | OC1=C(C2=CC=C3[C@](C)([C@]4(CC[C@]3(C2=CC1=O)C)C)CC[C@@]5(C)CC[C@@](C(O)=O)(C[C@]54[H])C)C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19865 | Quassin (Standard) | Inquiry |
|
| PDP-15381 | Macranthoidin B | Inquiry |
|
| PDP-15459 | 6"-O-Acetyldaidzin | Inquiry |
|
| PDP-14881 | 12-Ethyl-9-hydroxycamptothecin | Inquiry |
|
| PDP-14475 | Marrubiin | Inquiry |
|
| PDP-12973 | Gardenia Blue Colorant | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
