Quassin (Standard) | CAS | 76-78-8 |
| Molecular Weight | 388.45 |
| Formula | C22H28O6 |
| SMILES | C[C@@H]([C@@]1(C[C@]2(OC(C[C@]([C@]2([C@]3([C@@]41C)[H])C)(C(C)=C(OC)C3=O)[H])=O)[H])[H])C=C(OC)C4=O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16980 | Lasiocarpine | Inquiry |
|
| PDP-18110 | Pedalitin | Inquiry |
|
| PDP-17922 | Rivulobirin B | Inquiry |
|
| PDP-12959 | Pygeum Extract | Inquiry |
|
| PDP-15798 | Caffeic Acid (Standard) | Inquiry |
|
| PDP-17992 | (+)-Guaiacin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
