Chamaejasmenin A | CAS | 89618-14-4 |
| Molecular Weight | 570.54 |
| Formula | C32H26O10 |
| SMILES | O=C1[C@@]([C@]2([H])[C@@H](C3=CC=C(C=C3)OC)OC4=CC(O)=CC(O)=C4C2=O)([H])[C@@H](C5=CC=C(C=C5)OC)OC6=CC(O)=CC(O)=C61 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16973 | Cylindrin | Inquiry |
|
| PDP-17125 | Albaspidin AA | Inquiry |
|
| PDP-18606 | Pseudocoptisine Acetate | Inquiry |
|
| PDP-15313 | Baptifoline | Inquiry |
|
| PDP-18477 | Angelol B | Inquiry |
|
| PDP-18615 | Shikonofuran A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
