Chondramide A | CAS No. | 172430-60-3 |
| Molecular Weight | 646.77 |
| Formula | C36H46N4O7 |
| SMILES | C/C(C[C@H](C)C(N[C@@H](C)C(N([C@H](CC1=CNC2=C1C=CC=C2)C(N[C@@H](C3=CC=C(O)C=C3)[C@@H]4OC)=O)C)=O)=O)=C/[C@@H](C)[C@@H](C)OC4=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23081 | Leuseramycin | Inquiry |
|
| MDP-12026 | 3-Methyl-2-oxovaleric Acid (Standard) | Inquiry |
|
| MDP-12396 | Tryptophol (Standard) | Inquiry |
|
| MDP-24247 | Galacardin B | Inquiry |
|
| MDP-23459 | Arisostatin B | Inquiry |
|
| MDP-22227 | Deltamycin A1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
