Chrysin | Synonyms | 5,7-Dihydroxyflavone |
| Appearance | Solid |
| CAS | 480-40-0 |
| Purity | 99.85% |
| Molecular Weight | 254.24 |
| Formula | C15H10O4 |
| Color | Light yellow to yellow |
| SMILES | OC1=C2C(OC(C3=CC=CC=C3)=CC2=O)=CC(O)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19109 | Hypoglaunine D | Inquiry |
|
| PDP-17907 | (rac)-Secodihydro-hydramicromelin B | Inquiry |
|
| PDP-14976 | Phthalide | Inquiry |
|
| PDP-15752 | 8-Geranyloxypsoralen | Inquiry |
|
| PDP-13945 | 10-Deacetylbaccatin III | Inquiry |
|
| PDP-15320 | Homoeriodictyol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
