Citrinin (Standard) | CAS No. | 518-75-2 |
| Molecular Weight | 250.25 |
| Formula | C13H14O5 |
| SMILES | O=C1C(C)=C2[C@H]([C@@H](OC=C2C(O)=C1C(O)=O)C)C |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-21975 | Ganorbiformin B | Inquiry |
|
| MDP-12146 | 2'-Deoxycytidine (Standard) | Inquiry |
|
| MDP-22377 | K-13 | Inquiry |
|
| MDP-11833 | Prodigiosin Hydrochloride | Inquiry |
|
| MDP-24220 | 11-Deoxy-13-deoxodaunorubicin | Inquiry |
|
| MDP-23871 | Elsamicin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
