Ciwujianoside D1 | CAS | 114912-35-5 |
| Molecular Weight | 1101.27 |
| Formula | C55H88O22 |
| SMILES | CC(OC[C@H]([C@H]([C@@H]([C@H]1O)O)O[C@H]2[C@@H]([C@@H]([C@H]([C@@H](O2)C)O)O)O)O[C@H]1OC[C@H]([C@H]([C@@H]([C@H]3O)O)O)O[C@H]3OC([C@]45[C@](CC(C)(CC5)C)([H])C6=CC[C@@]([C@@]7([C@@](C(C)([C@H](CC7)O[C@H]8[C@@H]([C@H]([C@H](CO8)O)O)O)C)([H])CC9)C)([H])[C@]9(C)[C@@]6(CC4)C)=O)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18839 | Gomisin S | Inquiry |
|
| PDP-17489 | Xerophilusin A | Inquiry |
|
| PDP-12989 | Marigold Extract Lutein Ester | Inquiry |
|
| PDP-14360 | Oxyberberine | Inquiry |
|
| PDP-17174 | Maculosidine | Inquiry |
|
| PDP-18903 | Yadanziolide B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.