(+)-Columbianetin | Synonyms | (S)-Columbianetin |
| Appearance | Solid |
| CAS | 3804-70-4 |
| Purity | 99.04% |
| Molecular Weight | 246.26 |
| Formula | C14H14O4 |
| Color | Off-white to light yellow |
| SMILES | O=C1C=CC2=CC=C(O[C@H](C(C)(O)C)C3)C3=C2O1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18688 | Securitinine | Inquiry |
|
| PDP-18043 | 6'-O-Cinnamoyl-8-epikingisidic Acid | Inquiry |
|
| PDP-19011 | Angelol H | Inquiry |
|
| PDP-15907 | trans-4-(Trifluoromethyl)cinnamic Acid | Inquiry |
|
| PDP-14344 | Obtusifolin | Inquiry |
|
| PDP-14148 | Ferulic Acid Acyl-β-D-glucoside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
