Securitinine | CAS | 13861-71-7 |
| Molecular Weight | 247.29 |
| Formula | C14H17NO3 |
| SMILES | O=C(O1)C=C2[C@@]13[C@@](C[C@@H](OC)CC4)([H])N4[C@](C3)([H])C=C2 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20332 | Isorhamnetin (Standard) | Inquiry |
|
| PDP-19093 | Vitedoin A | Inquiry |
|
| PDP-19396 | Subelliptenone G | Inquiry |
|
| PDP-17619 | Trachelogenin 4'-O-β-gentiobioside | Inquiry |
|
| PDP-17861 | 11α-O-Tigloyl-12β-O-acetyltenacigenin B | Inquiry |
|
| PDP-14544 | Racanisodamine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
