Coriatin | CAS | 91653-75-7 |
| Molecular Weight | 296.32 |
| Formula | C15H20O6 |
| SMILES | CC(C)(O)[C@@H]1[C@@H](O2)C[C@]([C@@]3(CO3)[C@H]4[C@@H]5O4)(C)[C@]5(O)[C@H]1C2=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17535 | Solidagolactone II | Inquiry |
|
| PDP-15444 | Isosilybin B | Inquiry |
|
| PDP-15737 | (E)-3,4-Dimethoxycinnamic Acid | Inquiry |
|
| PDP-19834 | (-)-Catechin (Standard) | Inquiry |
|
| PDP-18110 | Pedalitin | Inquiry |
|
| PDP-17013 | Kievitone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
