Coronarin B | CAS | 119188-38-4 |
| Molecular Weight | 334.45 |
| Formula | C20H30O4 |
| SMILES | C[C@@]12C(C3C=C(CC(O)OO3)C=O)C(CCC1C(C)(CCC2)C)=C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14978 | Allyl Methyl Trisulfide | Inquiry |
|
| PDP-18156 | Morachalcone A | Inquiry |
|
| PDP-20009 | Luteolin-4'-O-glucoside (Standard) | Inquiry |
|
| PDP-16822 | Cirsiliol 4'-glucoside | Inquiry |
|
| PDP-18904 | Germacrone 4,5-epoxide | Inquiry |
|
| PDP-18895 | Frangulin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
